C24H33ClN6O6S — CID 70049357
(3S)-N-[(4-carbamimidoylmorpholin-2-yl)methyl]-4-morpholin-4-yl-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanamide;hydrochloride (PubChem CID 70049357) has the molecular formula C24H33ClN6O6S and a molecular weight of 569.08 g/mol. Its IUPAC name is (3S)-N-[(4-carbamimidoylmorpholin-2-yl)methyl]-4-morpholin-4-yl-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanamide;hydrochloride.
| Compound Name | (3S)-N-[(4-carbamimidoylmorpholin-2-yl)methyl]-4-morpholin-4-yl-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanamide;hydrochloride |
|---|---|
| PubChem CID | 70049357 |
| Molecular Formula | C24H33ClN6O6S |
| Molecular Weight | 569.08 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | (3S)-N-[(4-carbamimidoylmorpholin-2-yl)methyl]-4-morpholin-4-yl-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCOC(CNC(=O)C[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C24H32N6O6S.ClH/c25-24(26)30-9-12-36-19(16-30)15-27-22(31)14-21(23(32)29-7-10-35-11-8-29)28-37(33,34)20-6-5-17-3-1-2-4-18(17)13-20;/h1-6,13,19,21,28H,7-12,14-16H2,(H3,25,26)(H,27,31);1H/t19?,21-;/m0./s1 |
| InChIKey | MHSKWNRDRRSQQG-ANQAEFHNSA-N |
| XLogP | -0.13 |
| TPSA | 167.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.08 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|