C26H36N6O5S — CID 67630137
2-[(4-tert-butylphenyl)sulfonylamino]-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-3-(4-nitrophenyl)propanamide (PubChem CID 67630137) has the molecular formula C26H36N6O5S and a molecular weight of 544.68 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)sulfonylamino]-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-3-(4-nitrophenyl)propanamide.
| Compound Name | 2-[(4-tert-butylphenyl)sulfonylamino]-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 67630137 |
| Molecular Formula | C26H36N6O5S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 2-[(4-tert-butylphenyl)sulfonylamino]-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-3-(4-nitrophenyl)propanamide |
| SMILES | [H]/N=C(\N)N1CCCC(N(C)C(=O)C(Cc2ccc([N+](=O)[O-])cc2)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C26H36N6O5S/c1-26(2,3)19-9-13-22(14-10-19)38(36,37)29-23(16-18-7-11-20(12-8-18)32(34)35)24(33)30(4)21-6-5-15-31(17-21)25(27)28/h7-14,21,23,29H,5-6,15-17H2,1-4H3,(H3,27,28) |
| InChIKey | WLPKSSMBMHDPCY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|