C24H27N7O7S — CID 67630105
N-[(3S)-1-carbamimidoylpiperidin-3-yl]-3-(2,3-dioxoindol-1-yl)-N-methyl-2-[(2-nitrophenyl)sulfonylamino]propanamide (PubChem CID 67630105) has the molecular formula C24H27N7O7S and a molecular weight of 557.59 g/mol. Its IUPAC name is N-[(3S)-1-carbamimidoylpiperidin-3-yl]-3-(2,3-dioxoindol-1-yl)-N-methyl-2-[(2-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | N-[(3S)-1-carbamimidoylpiperidin-3-yl]-3-(2,3-dioxoindol-1-yl)-N-methyl-2-[(2-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 67630105 |
| Molecular Formula | C24H27N7O7S |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | N-[(3S)-1-carbamimidoylpiperidin-3-yl]-3-(2,3-dioxoindol-1-yl)-N-methyl-2-[(2-nitrophenyl)sulfonylamino]propanamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H](N(C)C(=O)C(CN2C(=O)C(=O)c3ccccc32)NS(=O)(=O)c2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C24H27N7O7S/c1-28(15-7-6-12-29(13-15)24(25)26)22(33)17(14-30-18-9-3-2-8-16(18)21(32)23(30)34)27-39(37,38)20-11-5-4-10-19(20)31(35)36/h2-5,8-11,15,17,27H,6-7,12-14H2,1H3,(H3,25,26)/t15-,17?/m0/s1 |
| InChIKey | ZAKQTULGJDBZKU-MYJWUSKBSA-N |
| XLogP | 0.29 |
| TPSA | 200.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|