C31H34N4O6S — CID 66616122
N-[1-[4-(3,3-dimethyl-2-oxoindol-1-yl)piperidin-1-yl]-1-oxo-4-phenylbutan-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 66616122) has the molecular formula C31H34N4O6S and a molecular weight of 590.70 g/mol. Its IUPAC name is N-[1-[4-(3,3-dimethyl-2-oxoindol-1-yl)piperidin-1-yl]-1-oxo-4-phenylbutan-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[1-[4-(3,3-dimethyl-2-oxoindol-1-yl)piperidin-1-yl]-1-oxo-4-phenylbutan-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 66616122 |
| Molecular Formula | C31H34N4O6S |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | N-[1-[4-(3,3-dimethyl-2-oxoindol-1-yl)piperidin-1-yl]-1-oxo-4-phenylbutan-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | CC1(C)C(=O)N(C2CCN(C(=O)C(CCc3ccccc3)NS(=O)(=O)c3ccccc3[N+](=O)[O-])CC2)c2ccccc21 |
| InChI | InChI=1S/C31H34N4O6S/c1-31(2)24-12-6-7-13-26(24)34(30(31)37)23-18-20-33(21-19-23)29(36)25(17-16-22-10-4-3-5-11-22)32-42(40,41)28-15-9-8-14-27(28)35(38)39/h3-15,23,25,32H,16-21H2,1-2H3 |
| InChIKey | YVMIOSNKJVYQRJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|