C24H30N6O7S — CID 54520957
methyl 2-[[(2R)-1-[(1-carbamimidoylpiperidin-3-yl)methylamino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]sulfamoyl]benzoate (PubChem CID 54520957) has the molecular formula C24H30N6O7S and a molecular weight of 546.61 g/mol. Its IUPAC name is methyl 2-[[(2R)-1-[(1-carbamimidoylpiperidin-3-yl)methylamino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]sulfamoyl]benzoate.
| Compound Name | methyl 2-[[(2R)-1-[(1-carbamimidoylpiperidin-3-yl)methylamino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 54520957 |
| Molecular Formula | C24H30N6O7S |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | methyl 2-[[(2R)-1-[(1-carbamimidoylpiperidin-3-yl)methylamino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]sulfamoyl]benzoate |
| SMILES | [H]/N=C(\N)N1CCCC(CNC(=O)[C@@H](Cc2ccc([N+](=O)[O-])cc2)NS(=O)(=O)c2ccccc2C(=O)OC)C1 |
| InChI | InChI=1S/C24H30N6O7S/c1-37-23(32)19-6-2-3-7-21(19)38(35,36)28-20(13-16-8-10-18(11-9-16)30(33)34)22(31)27-14-17-5-4-12-29(15-17)24(25)26/h2-3,6-11,17,20,28H,4-5,12-15H2,1H3,(H3,25,26)(H,27,31)/t17?,20-/m1/s1 |
| InChIKey | YPTUDXNZIOEIRC-UUSAFJCLSA-N |
| XLogP | 0.99 |
| TPSA | 197.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|