C24H29ClN6O5S2 — CID 67655168
2-(1-benzothiophen-3-ylsulfonylamino)-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-3-(4-nitrophenyl)propanamide;hydrochloride (PubChem CID 67655168) has the molecular formula C24H29ClN6O5S2 and a molecular weight of 581.12 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-ylsulfonylamino)-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-3-(4-nitrophenyl)propanamide;hydrochloride.
| Compound Name | 2-(1-benzothiophen-3-ylsulfonylamino)-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-3-(4-nitrophenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 67655168 |
| Molecular Formula | C24H29ClN6O5S2 |
| Molecular Weight | 581.12 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | 2-(1-benzothiophen-3-ylsulfonylamino)-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-3-(4-nitrophenyl)propanamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCCC(N(C)C(=O)C(Cc2ccc([N+](=O)[O-])cc2)NS(=O)(=O)c2csc3ccccc23)C1 |
| InChI | InChI=1S/C24H28N6O5S2.ClH/c1-28(18-5-4-12-29(14-18)24(25)26)23(31)20(13-16-8-10-17(11-9-16)30(32)33)27-37(34,35)22-15-36-21-7-3-2-6-19(21)22;/h2-3,6-11,15,18,20,27H,4-5,12-14H2,1H3,(H3,25,26);1H |
| InChIKey | YAMXRIXWLHDPMD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|