C24H29N3O4S — CID 142626961
3-(4-cyanophenyl)-N-cyclopentyl-2-[(4-ethoxyphenyl)sulfonylamino]-N-methylpropanamide (PubChem CID 142626961) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-N-cyclopentyl-2-[(4-ethoxyphenyl)sulfonylamino]-N-methylpropanamide.
| Compound Name | 3-(4-cyanophenyl)-N-cyclopentyl-2-[(4-ethoxyphenyl)sulfonylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 142626961 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-(4-cyanophenyl)-N-cyclopentyl-2-[(4-ethoxyphenyl)sulfonylamino]-N-methylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(Cc2ccc(C#N)cc2)C(=O)N(C)C2CCCC2)cc1 |
| InChI | InChI=1S/C24H29N3O4S/c1-3-31-21-12-14-22(15-13-21)32(29,30)26-23(16-18-8-10-19(17-25)11-9-18)24(28)27(2)20-6-4-5-7-20/h8-15,20,23,26H,3-7,16H2,1-2H3 |
| InChIKey | LYHHIFMUIZYNOW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |