C20H30Cl2N6O3S — CID 67725419
2-amino-4-[(3S)-1-carbamimidoylpiperidin-3-yl]-3-(naphthalen-2-ylsulfonylamino)butanamide;dihydrochloride (PubChem CID 67725419) has the molecular formula C20H30Cl2N6O3S and a molecular weight of 505.47 g/mol. Its IUPAC name is 2-amino-4-[(3S)-1-carbamimidoylpiperidin-3-yl]-3-(naphthalen-2-ylsulfonylamino)butanamide;dihydrochloride.
| Compound Name | 2-amino-4-[(3S)-1-carbamimidoylpiperidin-3-yl]-3-(naphthalen-2-ylsulfonylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 67725419 |
| Molecular Formula | C20H30Cl2N6O3S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 2-amino-4-[(3S)-1-carbamimidoylpiperidin-3-yl]-3-(naphthalen-2-ylsulfonylamino)butanamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)N1CCC[C@@H](CC(NS(=O)(=O)c2ccc3ccccc3c2)C(N)C(N)=O)C1 |
| InChI | InChI=1S/C20H28N6O3S.2ClH/c21-18(19(22)27)17(10-13-4-3-9-26(12-13)20(23)24)25-30(28,29)16-8-7-14-5-1-2-6-15(14)11-16;;/h1-2,5-8,11,13,17-18,25H,3-4,9-10,12,21H2,(H2,22,27)(H3,23,24);2*1H/t13-,17?,18?;;/m0../s1 |
| InChIKey | APNPUGHEBFGDDJ-QQNXEVTRSA-N |
| XLogP | 1.14 |
| TPSA | 168.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|