C27H37N7O6S — CID 67734161
(2S)-N'-[(3S)-1-carbamimidoylpiperidin-3-yl]-N-cyclopropyl-N-[2-(2-hydroxyethylamino)-2-oxoethyl]-2-(naphthalen-2-ylsulfonylamino)butanediamide (PubChem CID 67734161) has the molecular formula C27H37N7O6S and a molecular weight of 587.70 g/mol. Its IUPAC name is (2S)-N'-[(3S)-1-carbamimidoylpiperidin-3-yl]-N-cyclopropyl-N-[2-(2-hydroxyethylamino)-2-oxoethyl]-2-(naphthalen-2-ylsulfonylamino)butanediamide.
| Compound Name | (2S)-N'-[(3S)-1-carbamimidoylpiperidin-3-yl]-N-cyclopropyl-N-[2-(2-hydroxyethylamino)-2-oxoethyl]-2-(naphthalen-2-ylsulfonylamino)butanediamide |
|---|---|
| PubChem CID | 67734161 |
| Molecular Formula | C27H37N7O6S |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | (2S)-N'-[(3S)-1-carbamimidoylpiperidin-3-yl]-N-cyclopropyl-N-[2-(2-hydroxyethylamino)-2-oxoethyl]-2-(naphthalen-2-ylsulfonylamino)butanediamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H](NC(=O)C[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N(CC(=O)NCCO)C2CC2)C1 |
| InChI | InChI=1S/C27H37N7O6S/c28-27(29)33-12-3-6-20(16-33)31-24(36)15-23(26(38)34(21-8-9-21)17-25(37)30-11-13-35)32-41(39,40)22-10-7-18-4-1-2-5-19(18)14-22/h1-2,4-5,7,10,14,20-21,23,32,35H,3,6,8-9,11-13,15-17H2,(H3,28,29)(H,30,37)(H,31,36)/t20-,23-/m0/s1 |
| InChIKey | NVQJKPIJKINWPE-REWPJTCUSA-N |
| XLogP | -0.55 |
| TPSA | 198.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|