C30H33N3O6S2 — CID 57287379
N-[(2R)-1-[(2S)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfanylmethyl]pyrrolidin-1-yl]-3-hydroxy-1-oxopropan-2-yl]naphthalene-2-sulfonamide (PubChem CID 57287379) has the molecular formula C30H33N3O6S2 and a molecular weight of 595.74 g/mol. Its IUPAC name is N-[(2R)-1-[(2S)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfanylmethyl]pyrrolidin-1-yl]-3-hydroxy-1-oxopropan-2-yl]naphthalene-2-sulfonamide.
| Compound Name | N-[(2R)-1-[(2S)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfanylmethyl]pyrrolidin-1-yl]-3-hydroxy-1-oxopropan-2-yl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 57287379 |
| Molecular Formula | C30H33N3O6S2 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | N-[(2R)-1-[(2S)-2-[4-(1,3-dioxoisoindol-2-yl)butylsulfanylmethyl]pyrrolidin-1-yl]-3-hydroxy-1-oxopropan-2-yl]naphthalene-2-sulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCSC[C@@H]1CCCN1C(=O)[C@@H](CO)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H33N3O6S2/c34-19-27(31-41(38,39)24-14-13-21-8-1-2-9-22(21)18-24)30(37)32-16-7-10-23(32)20-40-17-6-5-15-33-28(35)25-11-3-4-12-26(25)29(33)36/h1-4,8-9,11-14,18,23,27,31,34H,5-7,10,15-17,19-20H2/t23-,27+/m0/s1 |
| InChIKey | MQUNYYASZJVMBW-WNCULLNHSA-N |
| XLogP | 3.28 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|