C37H42N4O7S — CID 67766431
benzyl N-[4-[[1-[2-(naphthalen-2-ylsulfonylamino)-3-phenylmethoxypropanoyl]pyrrolidin-2-yl]methylamino]-4-oxobutyl]carbamate (PubChem CID 67766431) has the molecular formula C37H42N4O7S and a molecular weight of 686.83 g/mol. Its IUPAC name is benzyl N-[4-[[1-[2-(naphthalen-2-ylsulfonylamino)-3-phenylmethoxypropanoyl]pyrrolidin-2-yl]methylamino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[1-[2-(naphthalen-2-ylsulfonylamino)-3-phenylmethoxypropanoyl]pyrrolidin-2-yl]methylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 67766431 |
| Molecular Formula | C37H42N4O7S |
| Molecular Weight | 686.83 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | benzyl N-[4-[[1-[2-(naphthalen-2-ylsulfonylamino)-3-phenylmethoxypropanoyl]pyrrolidin-2-yl]methylamino]-4-oxobutyl]carbamate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)NCC1CCCN1C(=O)C(COCc1ccccc1)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C37H42N4O7S/c42-35(18-9-21-38-37(44)48-26-29-13-5-2-6-14-29)39-24-32-17-10-22-41(32)36(43)34(27-47-25-28-11-3-1-4-12-28)40-49(45,46)33-20-19-30-15-7-8-16-31(30)23-33/h1-8,11-16,19-20,23,32,34,40H,9-10,17-18,21-22,24-27H2,(H,38,44)(H,39,42) |
| InChIKey | CXPDEUPRKRBBRW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|