C23H33N5O6S2 — CID 70061997
2-[4-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methylsulfonyl]butyl]guanidine (PubChem CID 70061997) has the molecular formula C23H33N5O6S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is 2-[4-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methylsulfonyl]butyl]guanidine.
| Compound Name | 2-[4-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methylsulfonyl]butyl]guanidine |
|---|---|
| PubChem CID | 70061997 |
| Molecular Formula | C23H33N5O6S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 2-[4-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methylsulfonyl]butyl]guanidine |
| SMILES | NC(N)=NCCCCS(=O)(=O)C[C@@H]1CCCN1C(=O)[C@H](CO)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H33N5O6S2/c24-23(25)26-11-3-4-13-35(31,32)16-19-8-5-12-28(19)22(30)21(15-29)27-36(33,34)20-10-9-17-6-1-2-7-18(17)14-20/h1-2,6-7,9-10,14,19,21,27,29H,3-5,8,11-13,15-16H2,(H4,24,25,26)/t19-,21-/m0/s1 |
| InChIKey | OPVHSENWCVAXLH-FPOVZHCZSA-N |
| XLogP | -0.06 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|