C24H34N6O5S — CID 70060081
(2S)-N-[4-(diaminomethylideneamino)butyl]-1-[(2S,3R)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoyl]pyrrolidine-2-carboxamide (PubChem CID 70060081) has the molecular formula C24H34N6O5S and a molecular weight of 518.64 g/mol. Its IUPAC name is (2S)-N-[4-(diaminomethylideneamino)butyl]-1-[(2S,3R)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-(diaminomethylideneamino)butyl]-1-[(2S,3R)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70060081 |
| Molecular Formula | C24H34N6O5S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | (2S)-N-[4-(diaminomethylideneamino)butyl]-1-[(2S,3R)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoyl]pyrrolidine-2-carboxamide |
| SMILES | C[C@@H](O)[C@H](NS(=O)(=O)c1ccc2ccccc2c1)C(=O)N1CCC[C@H]1C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C24H34N6O5S/c1-16(31)21(29-36(34,35)19-11-10-17-7-2-3-8-18(17)15-19)23(33)30-14-6-9-20(30)22(32)27-12-4-5-13-28-24(25)26/h2-3,7-8,10-11,15-16,20-21,29,31H,4-6,9,12-14H2,1H3,(H,27,32)(H4,25,26,28)/t16-,20+,21+/m1/s1 |
| InChIKey | SRPVTEVXPLENHB-CZAAIQMYSA-N |
| XLogP | 0.03 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|