C21H40N8O3 — CID 24983850
(2S)-1-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]-N-[4-(diaminomethylideneamino)butyl]pyrrolidine-2-carboxamide (PubChem CID 24983850) has the molecular formula C21H40N8O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is (2S)-1-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]-N-[4-(diaminomethylideneamino)butyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]-N-[4-(diaminomethylideneamino)butyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24983850 |
| Molecular Formula | C21H40N8O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | (2S)-1-[(2S)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carbonyl]-N-[4-(diaminomethylideneamino)butyl]pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C21H40N8O3/c22-10-2-1-7-15(23)19(31)29-14-6-9-17(29)20(32)28-13-5-8-16(28)18(30)26-11-3-4-12-27-21(24)25/h15-17H,1-14,22-23H2,(H,26,30)(H4,24,25,27)/t15-,16-,17-/m0/s1 |
| InChIKey | QGLYOZBPYKBKHT-ULQDDVLXSA-N |
| XLogP | -1.41 |
| TPSA | 186.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|