C22H30N6O5S — CID 67766527
3-(diaminomethylideneamino)-N-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methyl]propanamide (PubChem CID 67766527) has the molecular formula C22H30N6O5S and a molecular weight of 490.59 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)-N-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methyl]propanamide.
| Compound Name | 3-(diaminomethylideneamino)-N-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 67766527 |
| Molecular Formula | C22H30N6O5S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 3-(diaminomethylideneamino)-N-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methyl]propanamide |
| SMILES | NC(N)=NCCC(=O)NC[C@@H]1CCCN1C(=O)[C@H](CO)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H30N6O5S/c23-22(24)25-10-9-20(30)26-13-17-6-3-11-28(17)21(31)19(14-29)27-34(32,33)18-8-7-15-4-1-2-5-16(15)12-18/h1-2,4-5,7-8,12,17,19,27,29H,3,6,9-11,13-14H2,(H,26,30)(H4,23,24,25)/t17-,19-/m0/s1 |
| InChIKey | QLATUNZZIRBECA-HKUYNNGSSA-N |
| XLogP | -0.75 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|