C13H26N6O3 — CID 167012056
N-[[(2S)-1-[(2S)-2-amino-3-hydroxypropanoyl]pyrrolidin-2-yl]methyl]-4-(diaminomethylideneamino)butanamide (PubChem CID 167012056) has the molecular formula C13H26N6O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[[(2S)-1-[(2S)-2-amino-3-hydroxypropanoyl]pyrrolidin-2-yl]methyl]-4-(diaminomethylideneamino)butanamide.
| Compound Name | N-[[(2S)-1-[(2S)-2-amino-3-hydroxypropanoyl]pyrrolidin-2-yl]methyl]-4-(diaminomethylideneamino)butanamide |
|---|---|
| PubChem CID | 167012056 |
| Molecular Formula | C13H26N6O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | N-[[(2S)-1-[(2S)-2-amino-3-hydroxypropanoyl]pyrrolidin-2-yl]methyl]-4-(diaminomethylideneamino)butanamide |
| SMILES | NC(N)=NCCCC(=O)NC[C@@H]1CCCN1C(=O)[C@@H](N)CO |
| InChI | InChI=1S/C13H26N6O3/c14-10(8-20)12(22)19-6-2-3-9(19)7-18-11(21)4-1-5-17-13(15)16/h9-10,20H,1-8,14H2,(H,18,21)(H4,15,16,17)/t9-,10-/m0/s1 |
| InChIKey | STCQPRRTUUKAEE-UWVGGRQHSA-N |
| XLogP | -2.53 |
| TPSA | 160.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|