C28H39ClN6O5S — CID 67734284
(2S)-N-cyclopropyl-N'-[(1-methanehydrazonoylpiperidin-4-yl)methyl]-2-(naphthalen-2-ylsulfonylamino)-N-(3-oxobutyl)butanediamide;hydrochloride (PubChem CID 67734284) has the molecular formula C28H39ClN6O5S and a molecular weight of 607.18 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-N'-[(1-methanehydrazonoylpiperidin-4-yl)methyl]-2-(naphthalen-2-ylsulfonylamino)-N-(3-oxobutyl)butanediamide;hydrochloride.
| Compound Name | (2S)-N-cyclopropyl-N'-[(1-methanehydrazonoylpiperidin-4-yl)methyl]-2-(naphthalen-2-ylsulfonylamino)-N-(3-oxobutyl)butanediamide;hydrochloride |
|---|---|
| PubChem CID | 67734284 |
| Molecular Formula | C28H39ClN6O5S |
| Molecular Weight | 607.18 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | (2S)-N-cyclopropyl-N'-[(1-methanehydrazonoylpiperidin-4-yl)methyl]-2-(naphthalen-2-ylsulfonylamino)-N-(3-oxobutyl)butanediamide;hydrochloride |
| SMILES | CC(=O)CCN(C(=O)[C@H](CC(=O)NCC1CCN(C=NN)CC1)NS(=O)(=O)c1ccc2ccccc2c1)C1CC1.Cl |
| InChI | InChI=1S/C28H38N6O5S.ClH/c1-20(35)10-15-34(24-7-8-24)28(37)26(17-27(36)30-18-21-11-13-33(14-12-21)19-31-29)32-40(38,39)25-9-6-22-4-2-3-5-23(22)16-25;/h2-6,9,16,19,21,24,26,32H,7-8,10-15,17-18,29H2,1H3,(H,30,36);1H/t26-;/m0./s1 |
| InChIKey | OLYVTTPNBKOPRO-SNYZSRNZSA-N |
| XLogP | 2.00 |
| TPSA | 154.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|