C33H42N6O9S — CID 67734231
acetic acid;2-[[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]-[(3-methoxyphenyl)methyl]amino]acetic acid (PubChem CID 67734231) has the molecular formula C33H42N6O9S and a molecular weight of 698.80 g/mol. Its IUPAC name is acetic acid;2-[[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]-[(3-methoxyphenyl)methyl]amino]acetic acid.
| Compound Name | acetic acid;2-[[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]-[(3-methoxyphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 67734231 |
| Molecular Formula | C33H42N6O9S |
| Molecular Weight | 698.80 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | acetic acid;2-[[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]-[(3-methoxyphenyl)methyl]amino]acetic acid |
| SMILES | CC(=O)O.COc1cccc(CN(CC(=O)O)C(=O)[C@H](CC(=O)NC[C@@H]2CCCN(C=NN)C2)NS(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C31H38N6O7S.C2H4O2/c1-44-26-10-4-6-22(14-26)19-37(20-30(39)40)31(41)28(16-29(38)33-17-23-7-5-13-36(18-23)21-34-32)35-45(42,43)27-12-11-24-8-2-3-9-25(24)15-27;1-2(3)4/h2-4,6,8-12,14-15,21,23,28,35H,5,7,13,16-20,32H2,1H3,(H,33,38)(H,39,40);1H3,(H,3,4)/t23-,28-;/m0./s1 |
| InChIKey | UNUXPIBIPTVOHO-DVASCVOVSA-N |
| XLogP | 1.82 |
| TPSA | 221.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.80 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|