C29H38N6O9S — CID 172843544
3-[cyclopropyl-[(2S)-4-[[4-[(ethoxycarbonylhydrazinylidene)methyl]morpholin-2-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]propanoic acid (PubChem CID 172843544) has the molecular formula C29H38N6O9S and a molecular weight of 646.72 g/mol. Its IUPAC name is 3-[cyclopropyl-[(2S)-4-[[4-[(ethoxycarbonylhydrazinylidene)methyl]morpholin-2-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | 3-[cyclopropyl-[(2S)-4-[[4-[(ethoxycarbonylhydrazinylidene)methyl]morpholin-2-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 172843544 |
| Molecular Formula | C29H38N6O9S |
| Molecular Weight | 646.72 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 3-[cyclopropyl-[(2S)-4-[[4-[(ethoxycarbonylhydrazinylidene)methyl]morpholin-2-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]propanoic acid |
| SMILES | CCOC(=O)NN=CN1CCOC(CNC(=O)C[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N(CCC(=O)O)C2CC2)C1 |
| InChI | InChI=1S/C29H38N6O9S/c1-2-43-29(40)32-31-19-34-13-14-44-23(18-34)17-30-26(36)16-25(28(39)35(22-8-9-22)12-11-27(37)38)33-45(41,42)24-10-7-20-5-3-4-6-21(20)15-24/h3-7,10,15,19,22-23,25,33H,2,8-9,11-14,16-18H2,1H3,(H,30,36)(H,32,40)(H,37,38)/t23?,25-/m0/s1 |
| InChIKey | XCQINZLNGJBACJ-YNMFNDETSA-N |
| XLogP | 0.85 |
| TPSA | 196.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.72 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|