C30H37ClN6O6S — CID 67734236
2-[benzyl-[(2S)-4-[(1-methanehydrazonoylpiperidin-4-yl)methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]acetic acid;hydrochloride (PubChem CID 67734236) has the molecular formula C30H37ClN6O6S and a molecular weight of 645.18 g/mol. Its IUPAC name is 2-[benzyl-[(2S)-4-[(1-methanehydrazonoylpiperidin-4-yl)methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]acetic acid;hydrochloride.
| Compound Name | 2-[benzyl-[(2S)-4-[(1-methanehydrazonoylpiperidin-4-yl)methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 67734236 |
| Molecular Formula | C30H37ClN6O6S |
| Molecular Weight | 645.18 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | 2-[benzyl-[(2S)-4-[(1-methanehydrazonoylpiperidin-4-yl)methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]acetic acid;hydrochloride |
| SMILES | Cl.NN=CN1CCC(CNC(=O)C[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N(CC(=O)O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H36N6O6S.ClH/c31-33-21-35-14-12-22(13-15-35)18-32-28(37)17-27(30(40)36(20-29(38)39)19-23-6-2-1-3-7-23)34-43(41,42)26-11-10-24-8-4-5-9-25(24)16-26;/h1-11,16,21-22,27,34H,12-15,17-20,31H2,(H,32,37)(H,38,39);1H/t27-;/m0./s1 |
| InChIKey | DZKKRGDRKBQGJP-YCBFMBTMSA-N |
| XLogP | 2.14 |
| TPSA | 174.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|