C27H33N7O7S — CID 86735377
2-[benzyl-[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]amino]acetic acid;molecular nitrogen (PubChem CID 86735377) has the molecular formula C27H33N7O7S and a molecular weight of 599.67 g/mol. Its IUPAC name is 2-[benzyl-[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]amino]acetic acid;molecular nitrogen.
| Compound Name | 2-[benzyl-[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]amino]acetic acid;molecular nitrogen |
|---|---|
| PubChem CID | 86735377 |
| Molecular Formula | C27H33N7O7S |
| Molecular Weight | 599.67 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | 2-[benzyl-[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]amino]acetic acid;molecular nitrogen |
| SMILES | COc1cc2ccc(S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N(CC(=O)O)Cc3ccccc3)cc2cc1OC.N#N |
| InChI | InChI=1S/C27H33N5O7S.N2/c1-38-23-14-19-10-11-21(13-20(19)15-24(23)39-2)40(36,37)31-22(9-6-12-30-27(28)29)26(35)32(17-25(33)34)16-18-7-4-3-5-8-18;1-2/h3-5,7-8,10-11,13-15,22,31H,6,9,12,16-17H2,1-2H3,(H,33,34)(H4,28,29,30);/t22-;/m0./s1 |
| InChIKey | DVLIJOFTTWBDEN-FTBISJDPSA-N |
| XLogP | 1.70 |
| TPSA | 234.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|