C27H39N5O7S — CID 57052909
[2-[cycloheptyl-(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]acetyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 57052909) has the molecular formula C27H39N5O7S and a molecular weight of 577.70 g/mol. Its IUPAC name is [2-[cycloheptyl-(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]acetyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | [2-[cycloheptyl-(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]acetyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 57052909 |
| Molecular Formula | C27H39N5O7S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | [2-[cycloheptyl-(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]acetyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | COc1cc2ccc(S(=O)(=O)N(CC(=O)OC(=O)[C@@H](N)CCCN=C(N)N)C3CCCCCC3)cc2cc1OC |
| InChI | InChI=1S/C27H39N5O7S/c1-37-23-15-18-11-12-21(14-19(18)16-24(23)38-2)40(35,36)32(20-8-5-3-4-6-9-20)17-25(33)39-26(34)22(28)10-7-13-31-27(29)30/h11-12,14-16,20,22H,3-10,13,17,28H2,1-2H3,(H4,29,30,31)/t22-/m0/s1 |
| InChIKey | AGTVXOSDVMRXAE-QFIPXVFZSA-N |
| XLogP | 2.02 |
| TPSA | 189.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|