C25H37N7O8S — CID 86735164
ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(2-methoxyethyl)amino]acetate;molecular nitrogen (PubChem CID 86735164) has the molecular formula C25H37N7O8S and a molecular weight of 595.68 g/mol. Its IUPAC name is ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(2-methoxyethyl)amino]acetate;molecular nitrogen.
| Compound Name | ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(2-methoxyethyl)amino]acetate;molecular nitrogen |
|---|---|
| PubChem CID | 86735164 |
| Molecular Formula | C25H37N7O8S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(2-methoxyethyl)amino]acetate;molecular nitrogen |
| SMILES | CCOC(=O)CN(CCOC)C(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)c1ccc2cc(OC)c(OC)cc2c1.N#N |
| InChI | InChI=1S/C25H37N5O8S.N2/c1-5-38-23(31)16-30(11-12-35-2)24(32)20(7-6-10-28-25(26)27)29-39(33,34)19-9-8-17-14-21(36-3)22(37-4)15-18(17)13-19;1-2/h8-9,13-15,20,29H,5-7,10-12,16H2,1-4H3,(H4,26,27,28);/t20-;/m0./s1 |
| InChIKey | UYCPJUVOFVPCND-BDQAORGHSA-N |
| XLogP | 0.63 |
| TPSA | 232.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|