C23H30N2O7S — CID 54159959
(3S)-4-[(2-ethoxy-2-oxoethyl)-pentylamino]-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanoic acid (PubChem CID 54159959) has the molecular formula C23H30N2O7S and a molecular weight of 478.57 g/mol. Its IUPAC name is (3S)-4-[(2-ethoxy-2-oxoethyl)-pentylamino]-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanoic acid.
| Compound Name | (3S)-4-[(2-ethoxy-2-oxoethyl)-pentylamino]-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54159959 |
| Molecular Formula | C23H30N2O7S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (3S)-4-[(2-ethoxy-2-oxoethyl)-pentylamino]-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanoic acid |
| SMILES | CCCCCN(CC(=O)OCC)C(=O)[C@H](CC(=O)O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H30N2O7S/c1-3-5-8-13-25(16-22(28)32-4-2)23(29)20(15-21(26)27)24-33(30,31)19-12-11-17-9-6-7-10-18(17)14-19/h6-7,9-12,14,20,24H,3-5,8,13,15-16H2,1-2H3,(H,26,27)/t20-/m0/s1 |
| InChIKey | ONSHJNUAROOBGS-FQEVSTJZSA-N |
| XLogP | 2.54 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|