C25H34N2O6S — CID 54313039
(3S)-4-[hexanoyl(pentyl)amino]-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanoic acid (PubChem CID 54313039) has the molecular formula C25H34N2O6S and a molecular weight of 490.62 g/mol. Its IUPAC name is (3S)-4-[hexanoyl(pentyl)amino]-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanoic acid.
| Compound Name | (3S)-4-[hexanoyl(pentyl)amino]-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54313039 |
| Molecular Formula | C25H34N2O6S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | (3S)-4-[hexanoyl(pentyl)amino]-3-(naphthalen-2-ylsulfonylamino)-4-oxobutanoic acid |
| SMILES | CCCCCC(=O)N(CCCCC)C(=O)[C@H](CC(=O)O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H34N2O6S/c1-3-5-7-13-23(28)27(16-10-6-4-2)25(31)22(18-24(29)30)26-34(32,33)21-15-14-19-11-8-9-12-20(19)17-21/h8-9,11-12,14-15,17,22,26H,3-7,10,13,16,18H2,1-2H3,(H,29,30)/t22-/m0/s1 |
| InChIKey | SMFSXCCWNJXQHB-QFIPXVFZSA-N |
| XLogP | 4.09 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|