C31H37NO8S — CID 10722028
benzyl 5-[(2-ethoxy-2-oxoethyl)-(3-methoxypropyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoate (PubChem CID 10722028) has the molecular formula C31H37NO8S and a molecular weight of 583.70 g/mol. Its IUPAC name is benzyl 5-[(2-ethoxy-2-oxoethyl)-(3-methoxypropyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoate.
| Compound Name | benzyl 5-[(2-ethoxy-2-oxoethyl)-(3-methoxypropyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 10722028 |
| Molecular Formula | C31H37NO8S |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | benzyl 5-[(2-ethoxy-2-oxoethyl)-(3-methoxypropyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoate |
| SMILES | CCOC(=O)CN(CCCOC)C(=O)C(CCC(=O)OCc1ccccc1)CS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H37NO8S/c1-3-39-30(34)21-32(18-9-19-38-2)31(35)27(15-17-29(33)40-22-24-10-5-4-6-11-24)23-41(36,37)28-16-14-25-12-7-8-13-26(25)20-28/h4-8,10-14,16,20,27H,3,9,15,17-19,21-23H2,1-2H3 |
| InChIKey | KXXISINUVNWAOK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|