C32H39NO5S — CID 19802326
benzyl 5-[2-acetyloxyethyl(pentyl)amino]-4-(naphthalen-2-ylsulfanylmethyl)-5-oxopentanoate (PubChem CID 19802326) has the molecular formula C32H39NO5S and a molecular weight of 549.73 g/mol. Its IUPAC name is benzyl 5-[2-acetyloxyethyl(pentyl)amino]-4-(naphthalen-2-ylsulfanylmethyl)-5-oxopentanoate.
| Compound Name | benzyl 5-[2-acetyloxyethyl(pentyl)amino]-4-(naphthalen-2-ylsulfanylmethyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 19802326 |
| Molecular Formula | C32H39NO5S |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | benzyl 5-[2-acetyloxyethyl(pentyl)amino]-4-(naphthalen-2-ylsulfanylmethyl)-5-oxopentanoate |
| SMILES | CCCCCN(CCOC(C)=O)C(=O)C(CCC(=O)OCc1ccccc1)CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H39NO5S/c1-3-4-10-19-33(20-21-37-25(2)34)32(36)29(16-18-31(35)38-23-26-11-6-5-7-12-26)24-39-30-17-15-27-13-8-9-14-28(27)22-30/h5-9,11-15,17,22,29H,3-4,10,16,18-21,23-24H2,1-2H3 |
| InChIKey | MDERSGBWTSMHOR-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|