C22H34N2O3 — CID 10624860
benzyl (4R)-4-amino-5-oxo-5-[pent-4-enyl(pentyl)amino]pentanoate (PubChem CID 10624860) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is benzyl (4R)-4-amino-5-oxo-5-[pent-4-enyl(pentyl)amino]pentanoate.
| Compound Name | benzyl (4R)-4-amino-5-oxo-5-[pent-4-enyl(pentyl)amino]pentanoate |
|---|---|
| PubChem CID | 10624860 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | benzyl (4R)-4-amino-5-oxo-5-[pent-4-enyl(pentyl)amino]pentanoate |
| SMILES | C=CCCCN(CCCCC)C(=O)[C@H](N)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H34N2O3/c1-3-5-10-16-24(17-11-6-4-2)22(26)20(23)14-15-21(25)27-18-19-12-8-7-9-13-19/h3,7-9,12-13,20H,1,4-6,10-11,14-18,23H2,2H3/t20-/m1/s1 |
| InChIKey | BBQWQEXLLCHVIK-HXUWFJFHSA-N |
| XLogP | 3.82 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|