C23H35Cl2NO3S — CID 10648259
5-[(3,4-dichlorophenyl)sulfanylmethyl]-6-(dipentylamino)-6-oxohexanoic acid (PubChem CID 10648259) has the molecular formula C23H35Cl2NO3S and a molecular weight of 476.51 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)sulfanylmethyl]-6-(dipentylamino)-6-oxohexanoic acid.
| Compound Name | 5-[(3,4-dichlorophenyl)sulfanylmethyl]-6-(dipentylamino)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 10648259 |
| Molecular Formula | C23H35Cl2NO3S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)sulfanylmethyl]-6-(dipentylamino)-6-oxohexanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)C(CCCC(=O)O)CSc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H35Cl2NO3S/c1-3-5-7-14-26(15-8-6-4-2)23(29)18(10-9-11-22(27)28)17-30-19-12-13-20(24)21(25)16-19/h12-13,16,18H,3-11,14-15,17H2,1-2H3,(H,27,28) |
| InChIKey | OEELWQWGOJBJKI-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|