C22H34BrNO4S — CID 11799201
4-[(3-bromophenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid (PubChem CID 11799201) has the molecular formula C22H34BrNO4S and a molecular weight of 488.49 g/mol. Its IUPAC name is 4-[(3-bromophenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid.
| Compound Name | 4-[(3-bromophenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11799201 |
| Molecular Formula | C22H34BrNO4S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 4-[(3-bromophenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)C(CCC(=O)O)CS(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H34BrNO4S/c1-3-5-7-14-24(15-8-6-4-2)22(27)18(12-13-21(25)26)17-29(28)20-11-9-10-19(23)16-20/h9-11,16,18H,3-8,12-15,17H2,1-2H3,(H,25,26) |
| InChIKey | RZAJTQLYXPEWEK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|