C26H41Cl2NO5S — CID 10578593
4-[(3,4-dichlorophenyl)sulfonylmethyl]-5-(diheptylamino)-5-oxopentanoic acid (PubChem CID 10578593) has the molecular formula C26H41Cl2NO5S and a molecular weight of 550.59 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)sulfonylmethyl]-5-(diheptylamino)-5-oxopentanoic acid.
| Compound Name | 4-[(3,4-dichlorophenyl)sulfonylmethyl]-5-(diheptylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10578593 |
| Molecular Formula | C26H41Cl2NO5S |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)sulfonylmethyl]-5-(diheptylamino)-5-oxopentanoic acid |
| SMILES | CCCCCCCN(CCCCCCC)C(=O)C(CCC(=O)O)CS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H41Cl2NO5S/c1-3-5-7-9-11-17-29(18-12-10-8-6-4-2)26(32)21(13-16-25(30)31)20-35(33,34)22-14-15-23(27)24(28)19-22/h14-15,19,21H,3-13,16-18,20H2,1-2H3,(H,30,31) |
| InChIKey | CFEKBXDGZWGECJ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|