C29H58N2O3 — CID 139816413
(4S)-5-(dioctylamino)-4-(octylamino)-5-oxopentanoic acid (PubChem CID 139816413) has the molecular formula C29H58N2O3 and a molecular weight of 482.79 g/mol. Its IUPAC name is (4S)-5-(dioctylamino)-4-(octylamino)-5-oxopentanoic acid.
| Compound Name | (4S)-5-(dioctylamino)-4-(octylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 139816413 |
| Molecular Formula | C29H58N2O3 |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 482.44 |
| IUPAC Name | (4S)-5-(dioctylamino)-4-(octylamino)-5-oxopentanoic acid |
| SMILES | CCCCCCCCN[C@@H](CCC(=O)O)C(=O)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C29H58N2O3/c1-4-7-10-13-16-19-24-30-27(22-23-28(32)33)29(34)31(25-20-17-14-11-8-5-2)26-21-18-15-12-9-6-3/h27,30H,4-26H2,1-3H3,(H,32,33)/t27-/m0/s1 |
| InChIKey | UVBDOFCTFLRQFT-MHZLTWQESA-N |
| XLogP | 7.72 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|