C22H34ClN3O4 — CID 67898893
(4S)-4-[(4-chlorophenyl)carbamoylamino]-5-(dipentylamino)-5-oxopentanoic acid (PubChem CID 67898893) has the molecular formula C22H34ClN3O4 and a molecular weight of 439.98 g/mol. Its IUPAC name is (4S)-4-[(4-chlorophenyl)carbamoylamino]-5-(dipentylamino)-5-oxopentanoic acid.
| Compound Name | (4S)-4-[(4-chlorophenyl)carbamoylamino]-5-(dipentylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67898893 |
| Molecular Formula | C22H34ClN3O4 |
| Molecular Weight | 439.98 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | (4S)-4-[(4-chlorophenyl)carbamoylamino]-5-(dipentylamino)-5-oxopentanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)[C@H](CCC(=O)O)NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H34ClN3O4/c1-3-5-7-15-26(16-8-6-4-2)21(29)19(13-14-20(27)28)25-22(30)24-18-11-9-17(23)10-12-18/h9-12,19H,3-8,13-16H2,1-2H3,(H,27,28)(H2,24,25,30)/t19-/m0/s1 |
| InChIKey | GFMBISIECXFEJK-IBGZPJMESA-N |
| XLogP | 4.90 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|