C22H36ClN3O2 — CID 57239303
2-[(3-chlorophenyl)carbamoylamino]-N,N-dipentylpentanamide (PubChem CID 57239303) has the molecular formula C22H36ClN3O2 and a molecular weight of 410.00 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)carbamoylamino]-N,N-dipentylpentanamide.
| Compound Name | 2-[(3-chlorophenyl)carbamoylamino]-N,N-dipentylpentanamide |
|---|---|
| PubChem CID | 57239303 |
| Molecular Formula | C22H36ClN3O2 |
| Molecular Weight | 410.00 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 2-[(3-chlorophenyl)carbamoylamino]-N,N-dipentylpentanamide |
| SMILES | CCCCCN(CCCCC)C(=O)C(CCC)NC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H36ClN3O2/c1-4-7-9-15-26(16-10-8-5-2)21(27)20(12-6-3)25-22(28)24-19-14-11-13-18(23)17-19/h11,13-14,17,20H,4-10,12,15-16H2,1-3H3,(H2,24,25,28) |
| InChIKey | HZDKKZZMKDIRKQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.00 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|