C25H41N3O6 — CID 70441983
5-(dipentylamino)-2-ethoxy-4-[(3-methoxyphenyl)carbamoylamino]-5-oxopentanoic acid (PubChem CID 70441983) has the molecular formula C25H41N3O6 and a molecular weight of 479.62 g/mol. Its IUPAC name is 5-(dipentylamino)-2-ethoxy-4-[(3-methoxyphenyl)carbamoylamino]-5-oxopentanoic acid.
| Compound Name | 5-(dipentylamino)-2-ethoxy-4-[(3-methoxyphenyl)carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70441983 |
| Molecular Formula | C25H41N3O6 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | 5-(dipentylamino)-2-ethoxy-4-[(3-methoxyphenyl)carbamoylamino]-5-oxopentanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)C(CC(OCC)C(=O)O)NC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C25H41N3O6/c1-5-8-10-15-28(16-11-9-6-2)23(29)21(18-22(24(30)31)34-7-3)27-25(32)26-19-13-12-14-20(17-19)33-4/h12-14,17,21-22H,5-11,15-16,18H2,1-4H3,(H,30,31)(H2,26,27,32) |
| InChIKey | LSLPLZIHOMPIQB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|