C14H20N2O4 — CID 938942
(2S,3R)-2-[(3-methoxyphenyl)carbamoylamino]-3-methylpentanoic acid (PubChem CID 938942) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2S,3R)-2-[(3-methoxyphenyl)carbamoylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[(3-methoxyphenyl)carbamoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 938942 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (2S,3R)-2-[(3-methoxyphenyl)carbamoylamino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](NC(=O)Nc1cccc(OC)c1)C(=O)O |
| InChI | InChI=1S/C14H20N2O4/c1-4-9(2)12(13(17)18)16-14(19)15-10-6-5-7-11(8-10)20-3/h5-9,12H,4H2,1-3H3,(H,17,18)(H2,15,16,19)/t9-,12+/m1/s1 |
| InChIKey | MYYQPSOBPGLTMO-SKDRFNHKSA-N |
| XLogP | 2.32 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |