C21H20N2O5 — CID 4966865
2-[(9,10-dioxoanthracen-2-yl)carbamoylamino]-3-methylpentanoic acid (PubChem CID 4966865) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[(9,10-dioxoanthracen-2-yl)carbamoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[(9,10-dioxoanthracen-2-yl)carbamoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 4966865 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-[(9,10-dioxoanthracen-2-yl)carbamoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O)C(=O)O |
| InChI | InChI=1S/C21H20N2O5/c1-3-11(2)17(20(26)27)23-21(28)22-12-8-9-15-16(10-12)19(25)14-7-5-4-6-13(14)18(15)24/h4-11,17H,3H2,1-2H3,(H,26,27)(H2,22,23,28) |
| InChIKey | VPTLIXAWHAPKKT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|