C13H20N4O3 — CID 77038240
1-(1-amino-1-hydroxyimino-3-methylbutan-2-yl)-3-(3-methoxyphenyl)urea (PubChem CID 77038240) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-(1-amino-1-hydroxyimino-3-methylbutan-2-yl)-3-(3-methoxyphenyl)urea.
| Compound Name | 1-(1-amino-1-hydroxyimino-3-methylbutan-2-yl)-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 77038240 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(1-amino-1-hydroxyimino-3-methylbutan-2-yl)-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NC(C(N)=NO)C(C)C)c1 |
| InChI | InChI=1S/C13H20N4O3/c1-8(2)11(12(14)17-19)16-13(18)15-9-5-4-6-10(7-9)20-3/h4-8,11,19H,1-3H3,(H2,14,17)(H2,15,16,18) |
| InChIKey | LQOQGOOYCPFJJD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|