C14H21N3O4 — CID 71584556
(2S)-N-hydroxy-2-[(3-methoxyphenyl)carbamoylamino]-4-methylpentanamide (PubChem CID 71584556) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2S)-N-hydroxy-2-[(3-methoxyphenyl)carbamoylamino]-4-methylpentanamide.
| Compound Name | (2S)-N-hydroxy-2-[(3-methoxyphenyl)carbamoylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 71584556 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (2S)-N-hydroxy-2-[(3-methoxyphenyl)carbamoylamino]-4-methylpentanamide |
| SMILES | COc1cccc(NC(=O)N[C@@H](CC(C)C)C(=O)NO)c1 |
| InChI | InChI=1S/C14H21N3O4/c1-9(2)7-12(13(18)17-20)16-14(19)15-10-5-4-6-11(8-10)21-3/h4-6,8-9,12,20H,7H2,1-3H3,(H,17,18)(H2,15,16,19)/t12-/m0/s1 |
| InChIKey | OWKQRQRELYLWMT-LBPRGKRZSA-N |
| XLogP | 1.74 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|