C31H30ClN3O2 — CID 10229409
N-benzyl-2-[(3-chlorophenyl)carbamoylamino]-3-phenyl-N-(2-phenylethyl)propanamide (PubChem CID 10229409) has the molecular formula C31H30ClN3O2 and a molecular weight of 512.05 g/mol. Its IUPAC name is N-benzyl-2-[(3-chlorophenyl)carbamoylamino]-3-phenyl-N-(2-phenylethyl)propanamide.
| Compound Name | N-benzyl-2-[(3-chlorophenyl)carbamoylamino]-3-phenyl-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 10229409 |
| Molecular Formula | C31H30ClN3O2 |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | N-benzyl-2-[(3-chlorophenyl)carbamoylamino]-3-phenyl-N-(2-phenylethyl)propanamide |
| SMILES | O=C(Nc1cccc(Cl)c1)NC(Cc1ccccc1)C(=O)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H30ClN3O2/c32-27-17-10-18-28(22-27)33-31(37)34-29(21-25-13-6-2-7-14-25)30(36)35(23-26-15-8-3-9-16-26)20-19-24-11-4-1-5-12-24/h1-18,22,29H,19-21,23H2,(H2,33,34,37) |
| InChIKey | FOYQBMWZBSOPOC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |