C16H14Cl2N2O3 — CID 4032418
2-[(3,5-dichlorophenyl)carbamoylamino]-3-phenylpropanoic acid (PubChem CID 4032418) has the molecular formula C16H14Cl2N2O3 and a molecular weight of 353.21 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)carbamoylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[(3,5-dichlorophenyl)carbamoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 4032418 |
| Molecular Formula | C16H14Cl2N2O3 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)carbamoylamino]-3-phenylpropanoic acid |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H14Cl2N2O3/c17-11-7-12(18)9-13(8-11)19-16(23)20-14(15(21)22)6-10-4-2-1-3-5-10/h1-5,7-9,14H,6H2,(H,21,22)(H2,19,20,23) |
| InChIKey | KOVPFIKRATYAOA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |