C18H20N2O5 — CID 5126450
2-[(3,5-dimethoxyphenyl)carbamoylamino]-3-phenylpropanoic acid (PubChem CID 5126450) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[(3,5-dimethoxyphenyl)carbamoylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[(3,5-dimethoxyphenyl)carbamoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 5126450 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[(3,5-dimethoxyphenyl)carbamoylamino]-3-phenylpropanoic acid |
| SMILES | COc1cc(NC(=O)NC(Cc2ccccc2)C(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-24-14-9-13(10-15(11-14)25-2)19-18(23)20-16(17(21)22)8-12-6-4-3-5-7-12/h3-7,9-11,16H,8H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | OGYJQEBJWLDRFN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |