C16H14F2N2O4 — CID 142875212
2-[(3,5-difluoro-4-hydroxyphenyl)carbamoylamino]-3-phenylpropanoic acid (PubChem CID 142875212) has the molecular formula C16H14F2N2O4 and a molecular weight of 336.29 g/mol. Its IUPAC name is 2-[(3,5-difluoro-4-hydroxyphenyl)carbamoylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[(3,5-difluoro-4-hydroxyphenyl)carbamoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 142875212 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[(3,5-difluoro-4-hydroxyphenyl)carbamoylamino]-3-phenylpropanoic acid |
| SMILES | O=C(Nc1cc(F)c(O)c(F)c1)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H14F2N2O4/c17-11-7-10(8-12(18)14(11)21)19-16(24)20-13(15(22)23)6-9-4-2-1-3-5-9/h1-5,7-8,13,21H,6H2,(H,22,23)(H2,19,20,24) |
| InChIKey | HMLRMGVTYODVOV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|