C11H11Cl2N3O4 — CID 63716230
(2S)-4-amino-2-[(3,5-dichlorophenyl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 63716230) has the molecular formula C11H11Cl2N3O4 and a molecular weight of 320.13 g/mol. Its IUPAC name is (2S)-4-amino-2-[(3,5-dichlorophenyl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(3,5-dichlorophenyl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63716230 |
| Molecular Formula | C11H11Cl2N3O4 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | (2S)-4-amino-2-[(3,5-dichlorophenyl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)Nc1cc(Cl)cc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C11H11Cl2N3O4/c12-5-1-6(13)3-7(2-5)15-11(20)16-8(10(18)19)4-9(14)17/h1-3,8H,4H2,(H2,14,17)(H,18,19)(H2,15,16,20)/t8-/m0/s1 |
| InChIKey | WVGSXGDXPFAIPU-QMMMGPOBSA-N |
| XLogP | 1.44 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |