C11H14Cl2N4O2 — CID 107654451
1-[(1Z)-1-amino-1-hydroxyiminobutan-2-yl]-3-(3,5-dichlorophenyl)urea (PubChem CID 107654451) has the molecular formula C11H14Cl2N4O2 and a molecular weight of 305.17 g/mol. Its IUPAC name is 1-[(1Z)-1-amino-1-hydroxyiminobutan-2-yl]-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-[(1Z)-1-amino-1-hydroxyiminobutan-2-yl]-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 107654451 |
| Molecular Formula | C11H14Cl2N4O2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-[(1Z)-1-amino-1-hydroxyiminobutan-2-yl]-3-(3,5-dichlorophenyl)urea |
| SMILES | CCC(NC(=O)Nc1cc(Cl)cc(Cl)c1)/C(N)=N/O |
| InChI | InChI=1S/C11H14Cl2N4O2/c1-2-9(10(14)17-19)16-11(18)15-8-4-6(12)3-7(13)5-8/h3-5,9,19H,2H2,1H3,(H2,14,17)(H2,15,16,18) |
| InChIKey | JALBNOKKIIZOLU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|