C25H34ClN3O2 — CID 18966478
2-[N-[(3-chlorophenyl)carbamoyl]anilino]-N,N-dipentylacetamide (PubChem CID 18966478) has the molecular formula C25H34ClN3O2 and a molecular weight of 444.02 g/mol. Its IUPAC name is 2-[N-[(3-chlorophenyl)carbamoyl]anilino]-N,N-dipentylacetamide.
| Compound Name | 2-[N-[(3-chlorophenyl)carbamoyl]anilino]-N,N-dipentylacetamide |
|---|---|
| PubChem CID | 18966478 |
| Molecular Formula | C25H34ClN3O2 |
| Molecular Weight | 444.02 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 2-[N-[(3-chlorophenyl)carbamoyl]anilino]-N,N-dipentylacetamide |
| SMILES | CCCCCN(CCCCC)C(=O)CN(C(=O)Nc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C25H34ClN3O2/c1-3-5-10-17-28(18-11-6-4-2)24(30)20-29(23-15-8-7-9-16-23)25(31)27-22-14-12-13-21(26)19-22/h7-9,12-16,19H,3-6,10-11,17-18,20H2,1-2H3,(H,27,31) |
| InChIKey | WLWMSPGNOAOVGK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.02 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|