C22H33N3O6 — CID 10503019
4-(dipentylcarbamoyl)-5-(4-nitroanilino)-5-oxopentanoic acid (PubChem CID 10503019) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-(dipentylcarbamoyl)-5-(4-nitroanilino)-5-oxopentanoic acid.
| Compound Name | 4-(dipentylcarbamoyl)-5-(4-nitroanilino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10503019 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 4-(dipentylcarbamoyl)-5-(4-nitroanilino)-5-oxopentanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)C(CCC(=O)O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H33N3O6/c1-3-5-7-15-24(16-8-6-4-2)22(29)19(13-14-20(26)27)21(28)23-17-9-11-18(12-10-17)25(30)31/h9-12,19H,3-8,13-16H2,1-2H3,(H,23,28)(H,26,27) |
| InChIKey | YECZYCGYOKRFCC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|