C22H34Cl2N2O3 — CID 10623208
N-(3,4-dichlorophenyl)-2-(2-methoxyethyl)-N',N'-dipentylpropanediamide (PubChem CID 10623208) has the molecular formula C22H34Cl2N2O3 and a molecular weight of 445.43 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(2-methoxyethyl)-N',N'-dipentylpropanediamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(2-methoxyethyl)-N',N'-dipentylpropanediamide |
|---|---|
| PubChem CID | 10623208 |
| Molecular Formula | C22H34Cl2N2O3 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(2-methoxyethyl)-N',N'-dipentylpropanediamide |
| SMILES | CCCCCN(CCCCC)C(=O)C(CCOC)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H34Cl2N2O3/c1-4-6-8-13-26(14-9-7-5-2)22(28)18(12-15-29-3)21(27)25-17-10-11-19(23)20(24)16-17/h10-11,16,18H,4-9,12-15H2,1-3H3,(H,25,27) |
| InChIKey | AEPDAKQQQSNHJX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|