C22H31Cl2N3O8 — CID 144670178
nitrooxymethyl 4-[(3,4-dichlorobenzoyl)amino]-5-[3-methoxypropyl(pentyl)amino]-5-oxopentanoate (PubChem CID 144670178) has the molecular formula C22H31Cl2N3O8 and a molecular weight of 536.41 g/mol. Its IUPAC name is nitrooxymethyl 4-[(3,4-dichlorobenzoyl)amino]-5-[3-methoxypropyl(pentyl)amino]-5-oxopentanoate.
| Compound Name | nitrooxymethyl 4-[(3,4-dichlorobenzoyl)amino]-5-[3-methoxypropyl(pentyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 144670178 |
| Molecular Formula | C22H31Cl2N3O8 |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | nitrooxymethyl 4-[(3,4-dichlorobenzoyl)amino]-5-[3-methoxypropyl(pentyl)amino]-5-oxopentanoate |
| SMILES | CCCCCN(CCCOC)C(=O)C(CCC(=O)OCO[N+](=O)[O-])NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H31Cl2N3O8/c1-3-4-5-11-26(12-6-13-33-2)22(30)19(9-10-20(28)34-15-35-27(31)32)25-21(29)16-7-8-17(23)18(24)14-16/h7-8,14,19H,3-6,9-13,15H2,1-2H3,(H,25,29) |
| InChIKey | VFNQQXWFRCSNCM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|