C23H33Cl2N3O4 — CID 10696285
methyl 4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-5-[3-methoxypropyl(pentyl)amino]-5-oxopentanoate (PubChem CID 10696285) has the molecular formula C23H33Cl2N3O4 and a molecular weight of 486.44 g/mol. Its IUPAC name is methyl 4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-5-[3-methoxypropyl(pentyl)amino]-5-oxopentanoate.
| Compound Name | methyl 4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-5-[3-methoxypropyl(pentyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 10696285 |
| Molecular Formula | C23H33Cl2N3O4 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | methyl 4-[(5,6-dichloro-1H-benzimidazol-2-yl)methyl]-5-[3-methoxypropyl(pentyl)amino]-5-oxopentanoate |
| SMILES | CCCCCN(CCCOC)C(=O)C(CCC(=O)OC)Cc1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C23H33Cl2N3O4/c1-4-5-6-10-28(11-7-12-31-2)23(30)16(8-9-22(29)32-3)13-21-26-19-14-17(24)18(25)15-20(19)27-21/h14-16H,4-13H2,1-3H3,(H,26,27) |
| InChIKey | YHZICOKCFMWUIH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|